C15H18N2O4 — CID 110660556
3,5-dimethoxy-N-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide (PubChem CID 110660556) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110660556 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3,5-dimethoxy-N-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCc2ncc(C)o2)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-10-9-17-14(21-10)4-5-16-15(18)11-6-12(19-2)8-13(7-11)20-3/h6-9H,4-5H2,1-3H3,(H,16,18) |
| InChIKey | PXWAOHACAWLSPM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |