C7H19N3O2 — CID 11066068
(2R,3S)-1-amino-4-(3-aminopropylamino)butane-2,3-diol (PubChem CID 11066068) has the molecular formula C7H19N3O2 and a molecular weight of 177.25 g/mol. Its IUPAC name is (2R,3S)-1-amino-4-(3-aminopropylamino)butane-2,3-diol.
| Compound Name | (2R,3S)-1-amino-4-(3-aminopropylamino)butane-2,3-diol |
|---|---|
| PubChem CID | 11066068 |
| Molecular Formula | C7H19N3O2 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2R,3S)-1-amino-4-(3-aminopropylamino)butane-2,3-diol |
| SMILES | NCCCNC[C@H](O)[C@H](O)CN |
| InChI | InChI=1S/C7H19N3O2/c8-2-1-3-10-5-7(12)6(11)4-9/h6-7,10-12H,1-5,8-9H2/t6-,7+/m1/s1 |
| InChIKey | CDBQKGZLMQISHM-RQJHMYQMSA-N |
| XLogP | -2.39 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|