C14H15FN2O3 — CID 110660779
ethyl N-[1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethyl]carbamate (PubChem CID 110660779) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is ethyl N-[1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethyl]carbamate.
| Compound Name | ethyl N-[1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 110660779 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | ethyl N-[1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethyl]carbamate |
| SMILES | CCOC(=O)NC(C)c1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C14H15FN2O3/c1-3-19-14(18)17-9(2)13-16-8-12(20-13)10-4-6-11(15)7-5-10/h4-9H,3H2,1-2H3,(H,17,18) |
| InChIKey | HLOFBGINPZIHFS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |