C15H17N3O — CID 110661159
N-[3-(3-methylphenyl)propyl]pyrazine-2-carboxamide (PubChem CID 110661159) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[3-(3-methylphenyl)propyl]pyrazine-2-carboxamide.
| Compound Name | N-[3-(3-methylphenyl)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110661159 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[3-(3-methylphenyl)propyl]pyrazine-2-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)c2cnccn2)c1 |
| InChI | InChI=1S/C15H17N3O/c1-12-4-2-5-13(10-12)6-3-7-18-15(19)14-11-16-8-9-17-14/h2,4-5,8-11H,3,6-7H2,1H3,(H,18,19) |
| InChIKey | FCEURLUXKKXPGS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|