C18H24O3 — CID 11066126
methyl (4aS,8aS)-1,4a-dimethyl-2-oxo-4,6,7,8,9,10-hexahydro-3H-phenanthrene-8a-carboxylate (PubChem CID 11066126) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is methyl (4aS,8aS)-1,4a-dimethyl-2-oxo-4,6,7,8,9,10-hexahydro-3H-phenanthrene-8a-carboxylate.
| Compound Name | methyl (4aS,8aS)-1,4a-dimethyl-2-oxo-4,6,7,8,9,10-hexahydro-3H-phenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 11066126 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | methyl (4aS,8aS)-1,4a-dimethyl-2-oxo-4,6,7,8,9,10-hexahydro-3H-phenanthrene-8a-carboxylate |
| SMILES | COC(=O)[C@]12CCCC=C1[C@@]1(C)CCC(=O)C(C)=C1CC2 |
| InChI | InChI=1S/C18H24O3/c1-12-13-7-11-18(16(20)21-3)9-5-4-6-15(18)17(13,2)10-8-14(12)19/h6H,4-5,7-11H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | PYRZWDCBYGRESL-ROUUACIJSA-N |
| XLogP | 3.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|