C16H24N2O3 — CID 110662312
(3,4-dimethoxyphenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone (PubChem CID 110662312) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone.
| Compound Name | (3,4-dimethoxyphenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110662312 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CC(C)N(C)C(C)C2)cc1OC |
| InChI | InChI=1S/C16H24N2O3/c1-11-9-18(10-12(2)17(11)3)16(19)13-6-7-14(20-4)15(8-13)21-5/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | UXRMPUYFQDFSBG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |