C15H21ClN2O — CID 110662368
2-(2-chlorophenyl)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone (PubChem CID 110662368) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110662368 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone |
| SMILES | CC1CN(C(=O)Cc2ccccc2Cl)CC(C)N1C |
| InChI | InChI=1S/C15H21ClN2O/c1-11-9-18(10-12(2)17(11)3)15(19)8-13-6-4-5-7-14(13)16/h4-7,11-12H,8-10H2,1-3H3 |
| InChIKey | ZVXWZTDEPDHMHN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |