C9H7F7O3 — CID 11066365
6-(1,1,2,2,3,3,3-heptafluoropropyl)-3-hydroxy-3-methyl-2H-pyran-4-one (PubChem CID 11066365) has the molecular formula C9H7F7O3 and a molecular weight of 296.14 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,3-heptafluoropropyl)-3-hydroxy-3-methyl-2H-pyran-4-one.
| Compound Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-3-hydroxy-3-methyl-2H-pyran-4-one |
|---|---|
| PubChem CID | 11066365 |
| Molecular Formula | C9H7F7O3 |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-3-hydroxy-3-methyl-2H-pyran-4-one |
| SMILES | CC1(O)COC(C(F)(F)C(F)(F)C(F)(F)F)=CC1=O |
| InChI | InChI=1S/C9H7F7O3/c1-6(18)3-19-5(2-4(6)17)7(10,11)8(12,13)9(14,15)16/h2,18H,3H2,1H3 |
| InChIKey | YYVWPBDZYMJZGC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|