C20H28O2 — CID 11066536
(2E,5E)-2-[3-(furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal (PubChem CID 11066536) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2E,5E)-2-[3-(furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal.
| Compound Name | (2E,5E)-2-[3-(furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal |
|---|---|
| PubChem CID | 11066536 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (2E,5E)-2-[3-(furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C=O)=C\CCc1ccoc1 |
| InChI | InChI=1S/C20H28O2/c1-17(2)7-4-8-18(3)9-5-10-19(15-21)11-6-12-20-13-14-22-16-20/h7,9,11,13-16H,4-6,8,10,12H2,1-3H3/b18-9+,19-11+ |
| InChIKey | ZLSZDAIXQRVXSG-ZYCAGONGSA-N |
| XLogP | 5.81 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|