C18H22O4 — CID 11066599
[(1R,4aS,8aS)-3-(4-methylpent-3-enyl)-5,8-dioxo-1,4,4a,8a-tetrahydronaphthalen-1-yl] acetate (PubChem CID 11066599) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(1R,4aS,8aS)-3-(4-methylpent-3-enyl)-5,8-dioxo-1,4,4a,8a-tetrahydronaphthalen-1-yl] acetate.
| Compound Name | [(1R,4aS,8aS)-3-(4-methylpent-3-enyl)-5,8-dioxo-1,4,4a,8a-tetrahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 11066599 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(1R,4aS,8aS)-3-(4-methylpent-3-enyl)-5,8-dioxo-1,4,4a,8a-tetrahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C(CCC=C(C)C)C[C@@H]2C(=O)C=CC(=O)[C@@H]21 |
| InChI | InChI=1S/C18H22O4/c1-11(2)5-4-6-13-9-14-15(20)7-8-16(21)18(14)17(10-13)22-12(3)19/h5,7-8,10,14,17-18H,4,6,9H2,1-3H3/t14-,17-,18-/m1/s1 |
| InChIKey | BFLNYUAAFPJQEK-ZTFGCOKTSA-N |
| XLogP | 2.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|