About 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane
1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane (PubChem CID 110666756) has the molecular formula C12H18N4O3S
and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane.
Molecular Properties
| Compound Name | 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane |
| PubChem CID | 110666756 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCCNC2=O)cc1 |
| InChI | InChI=1S/C12H18N4O3S/c1-15(2)20(18,19)14-10-4-6-11(7-5-10)16-9-3-8-13-12(16)17/h4-7,14H,3,8-9H2,1-2H3,(H,13,17) |
| InChIKey | QMFQGCQCOLPYGV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane?
The IUPAC name of 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane (CID 110666756) is 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane.
What is the SMILES notation for 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane?
The canonical SMILES for 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane is CN(C)S(=O)(=O)Nc1ccc(N2CCCNC2=O)cc1.
What is the InChIKey of 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane?
The InChIKey is QMFQGCQCOLPYGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O3S/c1-15(2)20(18,19)14-10-4-6-11(7-5-10)16-9-3-8-13-12(16)17/h4-7,14H,3,8-9H2,1-2H3,(H,13,17).
What are the key properties of 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane?
1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane has a molecular weight of 298.37 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(dimethylsulfamoylamino)phenyl]-2-oxo-1,3-diazinane is sourced from PubChem (CID 110666756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).