C20H22N2O3S — CID 110667633
4-(2-oxopyrrolidin-1-yl)-N-[(E)-4-phenylbut-3-enyl]benzenesulfonamide (PubChem CID 110667633) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-N-[(E)-4-phenylbut-3-enyl]benzenesulfonamide.
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-N-[(E)-4-phenylbut-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110667633 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-N-[(E)-4-phenylbut-3-enyl]benzenesulfonamide |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)NCC/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20-10-6-16-22(20)18-11-13-19(14-12-18)26(24,25)21-15-5-4-9-17-7-2-1-3-8-17/h1-4,7-9,11-14,21H,5-6,10,15-16H2/b9-4+ |
| InChIKey | KLQDVMHRJFYVCP-RUDMXATFSA-N |
| XLogP | 3.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|