About [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane
[(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane (PubChem CID 11066817) has the molecular formula C20H24OSi
and a molecular weight of 308.50 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane.
Molecular Properties
| Compound Name | [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane |
| PubChem CID | 11066817 |
| Molecular Formula | C20H24OSi |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane |
| SMILES | C=C/C=C/O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H24OSi/c1-5-6-17-21-22(20(2,3)4,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h5-17H,1H2,2-4H3/b17-6+ |
| InChIKey | AWWLMZVOXPIMRH-UBKPWBPPSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane?
The IUPAC name of [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane (CID 11066817) is [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane.
What is the SMILES notation for [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane?
The canonical SMILES for [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane is C=C/C=C/O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane?
The InChIKey is AWWLMZVOXPIMRH-UBKPWBPPSA-N. The full InChI is InChI=1S/C20H24OSi/c1-5-6-17-21-22(20(2,3)4,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h5-17H,1H2,2-4H3/b17-6+.
What are the key properties of [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane?
[(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane has a molecular weight of 308.50 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-buta-1,3-dienoxy]-tert-butyl-diphenylsilane is sourced from PubChem (CID 11066817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).