About N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine
N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine (PubChem CID 110669374) has the molecular formula C8H20N2O2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine |
| PubChem CID | 110669374 |
| Molecular Formula | C8H20N2O2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine |
| SMILES | CN(C)S(=O)(=O)N(C)CC(C)(C)C |
| InChI | InChI=1S/C8H20N2O2S/c1-8(2,3)7-10(6)13(11,12)9(4)5/h7H2,1-6H3 |
| InChIKey | UPEQZVWFPIJMHS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine?
The IUPAC name of N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine (CID 110669374) is N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine.
What is the SMILES notation for N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine?
The canonical SMILES for N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine is CN(C)S(=O)(=O)N(C)CC(C)(C)C.
What is the InChIKey of N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine?
The InChIKey is UPEQZVWFPIJMHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2S/c1-8(2,3)7-10(6)13(11,12)9(4)5/h7H2,1-6H3.
What are the key properties of N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine?
N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine has a molecular weight of 208.33 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dimethylsulfamoyl)-N,2,2-trimethylpropan-1-amine is sourced from PubChem (CID 110669374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).