C21H20BNO — CID 11066960
(4R)-2-methyl-4,5,5-triphenyl-1,3,2-oxazaborolidine (PubChem CID 11066960) has the molecular formula C21H20BNO and a molecular weight of 313.21 g/mol. Its IUPAC name is (4R)-2-methyl-4,5,5-triphenyl-1,3,2-oxazaborolidine.
| Compound Name | (4R)-2-methyl-4,5,5-triphenyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 11066960 |
| Molecular Formula | C21H20BNO |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (4R)-2-methyl-4,5,5-triphenyl-1,3,2-oxazaborolidine |
| SMILES | CB1N[C@H](c2ccccc2)C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C21H20BNO/c1-22-23-20(17-11-5-2-6-12-17)21(24-22,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16,20,23H,1H3/t20-/m1/s1 |
| InChIKey | LDLRZFBSMOWZOS-HXUWFJFHSA-N |
| XLogP | 4.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|