C15H17FN2O4 — CID 110669941
methyl 4-[2-(4-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutanoate (PubChem CID 110669941) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is methyl 4-[2-(4-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[2-(4-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 110669941 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl 4-[2-(4-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCNC(=O)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN2O4/c1-22-13(20)7-6-12(19)18-9-8-17-15(21)14(18)10-2-4-11(16)5-3-10/h2-5,14H,6-9H2,1H3,(H,17,21) |
| InChIKey | KBRHTQVULSLVES-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |