About 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one
1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one (PubChem CID 110671550) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one.
Molecular Properties
| Compound Name | 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one |
| PubChem CID | 110671550 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one |
| SMILES | CCCC(=O)N1CCCc2c(OC)cc(OC)cc21 |
| InChI | InChI=1S/C15H21NO3/c1-4-6-15(17)16-8-5-7-12-13(16)9-11(18-2)10-14(12)19-3/h9-10H,4-8H2,1-3H3 |
| InChIKey | MLKFWMLDVYNBCJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one?
The IUPAC name of 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one (CID 110671550) is 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one.
What is the SMILES notation for 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one?
The canonical SMILES for 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one is CCCC(=O)N1CCCc2c(OC)cc(OC)cc21.
What is the InChIKey of 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one?
The InChIKey is MLKFWMLDVYNBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-4-6-15(17)16-8-5-7-12-13(16)9-11(18-2)10-14(12)19-3/h9-10H,4-8H2,1-3H3.
What are the key properties of 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one?
1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one has a molecular weight of 263.34 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,7-dimethoxy-3,4-dihydro-2H-quinolin-1-yl)butan-1-one is sourced from PubChem (CID 110671550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).