C13H14F3NO3S — CID 11067195
[(1S,9S)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate (PubChem CID 11067195) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is [(1S,9S)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,9S)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11067195 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | [(1S,9S)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)[C@@H]2Cc3nc(OS(=O)(=O)C(F)(F)F)ccc3[C@H]1C2 |
| InChI | InChI=1S/C13H14F3NO3S/c1-12(2)7-5-9(12)8-3-4-11(17-10(8)6-7)20-21(18,19)13(14,15)16/h3-4,7,9H,5-6H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | BMCSPKXRBPQPPR-IONNQARKSA-N |
| XLogP | 3.00 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|