C17H25ClN2O2 — CID 11067320
(3S,4R,5S)-2-tert-butyl-4-chloro-8,8-dimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane (PubChem CID 11067320) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is (3S,4R,5S)-2-tert-butyl-4-chloro-8,8-dimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane.
| Compound Name | (3S,4R,5S)-2-tert-butyl-4-chloro-8,8-dimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 11067320 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (3S,4R,5S)-2-tert-butyl-4-chloro-8,8-dimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane |
| SMILES | CC1(C)CO[C@]2(N1)ON(C(C)(C)C)[C@@H](c1ccccc1)[C@H]2Cl |
| InChI | InChI=1S/C17H25ClN2O2/c1-15(2,3)20-13(12-9-7-6-8-10-12)14(18)17(22-20)19-16(4,5)11-21-17/h6-10,13-14,19H,11H2,1-5H3/t13-,14+,17-/m0/s1 |
| InChIKey | XRIPTNUXVWNBOC-VBQJREDUSA-N |
| XLogP | 3.43 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|