C19H21N3O2 — CID 110673376
N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(dimethylamino)benzamide (PubChem CID 110673376) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(dimethylamino)benzamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 110673376 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(dimethylamino)benzamide |
| SMILES | CN(C)c1cccc(C(=O)NCC(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-21(2)16-8-5-7-15(12-16)19(24)20-13-18(23)22-11-10-14-6-3-4-9-17(14)22/h3-9,12H,10-11,13H2,1-2H3,(H,20,24) |
| InChIKey | UOGGOBUEPZKLPI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |