C12H26O6P2 — CID 11067413
4,4-bis(diethoxyphosphoryl)but-1-ene (PubChem CID 11067413) has the molecular formula C12H26O6P2 and a molecular weight of 328.28 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)but-1-ene.
| Compound Name | 4,4-bis(diethoxyphosphoryl)but-1-ene |
|---|---|
| PubChem CID | 11067413 |
| Molecular Formula | C12H26O6P2 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)but-1-ene |
| SMILES | C=CCC(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H26O6P2/c1-6-11-12(19(13,15-7-2)16-8-3)20(14,17-9-4)18-10-5/h6,12H,1,7-11H2,2-5H3 |
| InChIKey | RNKXZCSKJOMXQR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|