C16H26O7 — CID 11067483
(E,5S,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoic acid (PubChem CID 11067483) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is (E,5S,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoic acid.
| Compound Name | (E,5S,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoic acid |
|---|---|
| PubChem CID | 11067483 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (E,5S,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoic acid |
| SMILES | COCO[C@@H](C/C=C/C(=O)O)C[C@@H](C)OC(=O)/C=C/C[C@@H](C)O |
| InChI | InChI=1S/C16H26O7/c1-12(17)6-4-9-16(20)23-13(2)10-14(22-11-21-3)7-5-8-15(18)19/h4-5,8-9,12-14,17H,6-7,10-11H2,1-3H3,(H,18,19)/b8-5+,9-4+/t12-,13-,14+/m1/s1 |
| InChIKey | FAEZBZXEEIEKRN-DYMYSYLKSA-N |
| XLogP | 1.66 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|