C22H26N4O — CID 110675073
3-imidazo[1,5-a]pyridin-3-yl-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide (PubChem CID 110675073) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 3-imidazo[1,5-a]pyridin-3-yl-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide.
| Compound Name | 3-imidazo[1,5-a]pyridin-3-yl-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 110675073 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 3-imidazo[1,5-a]pyridin-3-yl-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide |
| SMILES | CC1CCN(c2ccc(NC(=O)CCc3ncc4ccccn34)cc2)CC1 |
| InChI | InChI=1S/C22H26N4O/c1-17-11-14-25(15-12-17)19-7-5-18(6-8-19)24-22(27)10-9-21-23-16-20-4-2-3-13-26(20)21/h2-8,13,16-17H,9-12,14-15H2,1H3,(H,24,27) |
| InChIKey | IDIIMZXLUMHNMA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|