C13H19N7O2S — CID 11067703
N-[[5-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,2,4-oxadiazol-3-yl]methyl]acetamide (PubChem CID 11067703) has the molecular formula C13H19N7O2S and a molecular weight of 337.41 g/mol. Its IUPAC name is N-[[5-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,2,4-oxadiazol-3-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,2,4-oxadiazol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11067703 |
| Molecular Formula | C13H19N7O2S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[[5-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,2,4-oxadiazol-3-yl]methyl]acetamide |
| SMILES | CCCC/N=C(\N)Nc1nc(-c2nc(CNC(C)=O)no2)cs1 |
| InChI | InChI=1S/C13H19N7O2S/c1-3-4-5-15-12(14)19-13-17-9(7-23-13)11-18-10(20-22-11)6-16-8(2)21/h7H,3-6H2,1-2H3,(H,16,21)(H3,14,15,17,19) |
| InChIKey | GAZJHDHTGXBTAM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|