C20H23N3O2 — CID 11067706
N-[[(1R,2R)-2-[(4-nitrophenyl)methylideneamino]cyclohexyl]methyl]aniline (PubChem CID 11067706) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[[(1R,2R)-2-[(4-nitrophenyl)methylideneamino]cyclohexyl]methyl]aniline.
| Compound Name | N-[[(1R,2R)-2-[(4-nitrophenyl)methylideneamino]cyclohexyl]methyl]aniline |
|---|---|
| PubChem CID | 11067706 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[[(1R,2R)-2-[(4-nitrophenyl)methylideneamino]cyclohexyl]methyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(/C=N/[C@@H]2CCCC[C@@H]2CNc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c24-23(25)19-12-10-16(11-13-19)14-22-20-9-5-4-6-17(20)15-21-18-7-2-1-3-8-18/h1-3,7-8,10-14,17,20-21H,4-6,9,15H2/b22-14+/t17-,20-/m1/s1 |
| InChIKey | ZPBSHBNKKXZUHU-SGECOUMVSA-N |
| XLogP | 4.68 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|