About propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate
propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate (PubChem CID 11067853) has the molecular formula C19H38O3Si
and a molecular weight of 342.60 g/mol. Its IUPAC name is propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate.
Molecular Properties
| Compound Name | propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate |
| PubChem CID | 11067853 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H](CC=C(C)C)[C@@H](C)CC(=O)OC(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-9-23(10-2,11-3)22-18(13-12-15(4)5)17(8)14-19(20)21-16(6)7/h12,16-18H,9-11,13-14H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | FVLMADDWHSNRSJ-ZWKOTPCHSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate?
The IUPAC name of propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate (CID 11067853) is propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate.
What is the SMILES notation for propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate?
The canonical SMILES for propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate is CC[Si](CC)(CC)O[C@H](CC=C(C)C)[C@@H](C)CC(=O)OC(C)C.
What is the InChIKey of propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate?
The InChIKey is FVLMADDWHSNRSJ-ZWKOTPCHSA-N. The full InChI is InChI=1S/C19H38O3Si/c1-9-23(10-2,11-3)22-18(13-12-15(4)5)17(8)14-19(20)21-16(6)7/h12,16-18H,9-11,13-14H2,1-8H3/t17-,18+/m0/s1.
What are the key properties of propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate?
propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate has a molecular weight of 342.60 g/mol, XLogP of 5.71, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (3S,4R)-3,7-dimethyl-4-triethylsilyloxyoct-6-enoate is sourced from PubChem (CID 11067853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).