About N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide
N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide (PubChem CID 110680155) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide |
| PubChem CID | 110680155 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)Cc2oc(C)nc2C)cc1 |
| InChI | InChI=1S/C15H17N3O3/c1-9-14(21-11(3)16-9)8-15(20)18-13-6-4-12(5-7-13)17-10(2)19/h4-7H,8H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | FJSMCBYUHRCADV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide?
The IUPAC name of N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide (CID 110680155) is N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide.
What is the SMILES notation for N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide?
The canonical SMILES for N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide is CC(=O)Nc1ccc(NC(=O)Cc2oc(C)nc2C)cc1.
What is the InChIKey of N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide?
The InChIKey is FJSMCBYUHRCADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c1-9-14(21-11(3)16-9)8-15(20)18-13-6-4-12(5-7-13)17-10(2)19/h4-7H,8H2,1-3H3,(H,17,19)(H,18,20).
What are the key properties of N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide?
N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide has a molecular weight of 287.32 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetamidophenyl)-2-(2,4-dimethyl-1,3-oxazol-5-yl)acetamide is sourced from PubChem (CID 110680155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).