C20H18N2O3 — CID 110680389
N-(4-acetylphenyl)-2-(3-methyl-2-oxoquinolin-1-yl)acetamide (PubChem CID 110680389) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(3-methyl-2-oxoquinolin-1-yl)acetamide.
| Compound Name | N-(4-acetylphenyl)-2-(3-methyl-2-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 110680389 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-(4-acetylphenyl)-2-(3-methyl-2-oxoquinolin-1-yl)acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)Cn2c(=O)c(C)cc3ccccc32)cc1 |
| InChI | InChI=1S/C20H18N2O3/c1-13-11-16-5-3-4-6-18(16)22(20(13)25)12-19(24)21-17-9-7-15(8-10-17)14(2)23/h3-11H,12H2,1-2H3,(H,21,24) |
| InChIKey | XVMPOXUWQSLHAH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |