C14H14N2OS — CID 110680621
N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide (PubChem CID 110680621) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 110680621 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCc2ncsc2C1 |
| InChI | InChI=1S/C14H14N2OS/c17-14(16-11-4-2-1-3-5-11)10-6-7-12-13(8-10)18-9-15-12/h1-5,9-10H,6-8H2,(H,16,17) |
| InChIKey | BGHSGRJXIURCOE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |