C11H13NOS — CID 110681267
N-cyclopropyl-2-thiophen-2-ylcyclopropane-1-carboxamide (PubChem CID 110681267) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is N-cyclopropyl-2-thiophen-2-ylcyclopropane-1-carboxamide.
| Compound Name | N-cyclopropyl-2-thiophen-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110681267 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | N-cyclopropyl-2-thiophen-2-ylcyclopropane-1-carboxamide |
| SMILES | O=C(NC1CC1)C1CC1c1cccs1 |
| InChI | InChI=1S/C11H13NOS/c13-11(12-7-3-4-7)9-6-8(9)10-2-1-5-14-10/h1-2,5,7-9H,3-4,6H2,(H,12,13) |
| InChIKey | RRVWAQLCBQJNFN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |