About N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide
N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 110682601) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 110682601 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cnoc1C |
| InChI | InChI=1S/C9H13N3O3/c1-6-8(5-12-15-6)9(14)11-4-3-10-7(2)13/h5H,3-4H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | XFXXKTWKZWOIRO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide (CID 110682601) is N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide is CC(=O)NCCNC(=O)c1cnoc1C.
What is the InChIKey of N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is XFXXKTWKZWOIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3/c1-6-8(5-12-15-6)9(14)11-4-3-10-7(2)13/h5H,3-4H2,1-2H3,(H,10,13)(H,11,14).
What are the key properties of N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide?
N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 211.22 g/mol, XLogP of -0.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetamidoethyl)-5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 110682601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).