C17H26O8 — CID 11068300
(2S,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-ol (PubChem CID 11068300) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2S,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-ol.
| Compound Name | (2S,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-ol |
|---|---|
| PubChem CID | 11068300 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (2S,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-ol |
| SMILES | CO[C@@H]1C=C[C@@H](O)[C@@]2(O1)[C@@H]([C@@H]1COC(C)(C)O1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H26O8/c1-15(2)20-8-9(22-15)12-17(10(18)6-7-11(19-5)23-17)13-14(21-12)25-16(3,4)24-13/h6-7,9-14,18H,8H2,1-5H3/t9-,10+,11-,12+,13-,14+,17+/m0/s1 |
| InChIKey | RSVDHSUUWSEXFS-ZEUAXSQRSA-N |
| XLogP | 0.67 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|