C13H25N3O3S — CID 110684423
1-(4-methylpiperidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 110684423) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 1-(4-methylpiperidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110684423 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)CN2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C13H25N3O3S/c1-12-3-5-15(6-4-12)13(17)11-14-7-9-16(10-8-14)20(2,18)19/h12H,3-11H2,1-2H3 |
| InChIKey | IWHRJFRWBPYFTA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |