C21H32O5 — CID 11068511
(2,6-ditert-butyl-4-methoxyphenyl) (2S,3S)-2-hydroxy-3-methyloxolane-2-carboxylate (PubChem CID 11068511) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) (2S,3S)-2-hydroxy-3-methyloxolane-2-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) (2S,3S)-2-hydroxy-3-methyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 11068511 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) (2S,3S)-2-hydroxy-3-methyloxolane-2-carboxylate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)[C@@]2(O)OCC[C@@H]2C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H32O5/c1-13-9-10-25-21(13,23)18(22)26-17-15(19(2,3)4)11-14(24-8)12-16(17)20(5,6)7/h11-13,23H,9-10H2,1-8H3/t13-,21-/m0/s1 |
| InChIKey | HWSCWJOUXRYTIY-ZSEKCTLFSA-N |
| XLogP | 3.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|