C18H13F5O3 — CID 11068707
ethyl (Z)-2-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3-phenylprop-2-enoate (PubChem CID 11068707) has the molecular formula C18H13F5O3 and a molecular weight of 372.29 g/mol. Its IUPAC name is ethyl (Z)-2-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3-phenylprop-2-enoate.
| Compound Name | ethyl (Z)-2-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 11068707 |
| Molecular Formula | C18H13F5O3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | ethyl (Z)-2-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccccc1)C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H13F5O3/c1-2-26-18(25)10(8-9-6-4-3-5-7-9)17(24)11-12(19)14(21)16(23)15(22)13(11)20/h3-8,17,24H,2H2,1H3/b10-8- |
| InChIKey | JHIJAQUBOITRSB-NTMALXAHSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|