C22H30O5 — CID 11068791
(4S,6R,7R,11S,14S)-14-benzyl-4,11,14-trimethyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one (PubChem CID 11068791) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4S,6R,7R,11S,14S)-14-benzyl-4,11,14-trimethyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one.
| Compound Name | (4S,6R,7R,11S,14S)-14-benzyl-4,11,14-trimethyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one |
|---|---|
| PubChem CID | 11068791 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4S,6R,7R,11S,14S)-14-benzyl-4,11,14-trimethyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one |
| SMILES | C[C@H]1CCC[C@]2(OC(=O)[C@](C)(Cc3ccccc3)O[C@]23CCC[C@H](C)O3)O1 |
| InChI | InChI=1S/C22H30O5/c1-16-9-7-13-21(24-16)22(14-8-10-17(2)25-22)27-20(3,19(23)26-21)15-18-11-5-4-6-12-18/h4-6,11-12,16-17H,7-10,13-15H2,1-3H3/t16-,17-,20-,21+,22+/m0/s1 |
| InChIKey | CKZJFWINWVHABT-ZBWQPJPKSA-N |
| XLogP | 4.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |