About 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol
1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol (PubChem CID 11068834) has the molecular formula C21H28O6
and a molecular weight of 376.45 g/mol. Its IUPAC name is 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol.
Molecular Properties
| Compound Name | 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol |
| PubChem CID | 11068834 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol |
| SMILES | COc1cc(CCC(O)CC(O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H28O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-12,16-17,22-25H,3-4,7-8,13H2,1-2H3 |
| InChIKey | OELMAFBLFOKZJD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol?
The IUPAC name of 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol (CID 11068834) is 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol.
What is the SMILES notation for 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol?
The canonical SMILES for 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol is COc1cc(CCC(O)CC(O)CCc2ccc(O)c(OC)c2)ccc1O.
What is the InChIKey of 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol?
The InChIKey is OELMAFBLFOKZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-12,16-17,22-25H,3-4,7-8,13H2,1-2H3.
What are the key properties of 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol?
1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol has a molecular weight of 376.45 g/mol, XLogP of 2.79, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol is sourced from PubChem (CID 11068834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).