C20H15F3S2 — CID 11068839
[2,2,2-trifluoro-1,1-bis(phenylsulfanyl)ethyl]benzene (PubChem CID 11068839) has the molecular formula C20H15F3S2 and a molecular weight of 376.47 g/mol. Its IUPAC name is [2,2,2-trifluoro-1,1-bis(phenylsulfanyl)ethyl]benzene.
| Compound Name | [2,2,2-trifluoro-1,1-bis(phenylsulfanyl)ethyl]benzene |
|---|---|
| PubChem CID | 11068839 |
| Molecular Formula | C20H15F3S2 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [2,2,2-trifluoro-1,1-bis(phenylsulfanyl)ethyl]benzene |
| SMILES | FC(F)(F)C(Sc1ccccc1)(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15F3S2/c21-20(22,23)19(16-10-4-1-5-11-16,24-17-12-6-2-7-13-17)25-18-14-8-3-9-15-18/h1-15H |
| InChIKey | KJLFZCDDDGERBF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|