About N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide
N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide (PubChem CID 110689389) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide |
| PubChem CID | 110689389 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1ocnc1-c1ccccc1 |
| InChI | InChI=1S/C15H18N2O2/c1-2-3-7-10-16-15(18)14-13(17-11-19-14)12-8-5-4-6-9-12/h4-6,8-9,11H,2-3,7,10H2,1H3,(H,16,18) |
| InChIKey | JEIJXOQKTAMNEP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide?
The IUPAC name of N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide (CID 110689389) is N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide is CCCCCNC(=O)c1ocnc1-c1ccccc1.
What is the InChIKey of N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide?
The InChIKey is JEIJXOQKTAMNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-2-3-7-10-16-15(18)14-13(17-11-19-14)12-8-5-4-6-9-12/h4-6,8-9,11H,2-3,7,10H2,1H3,(H,16,18).
What are the key properties of N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide?
N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide has a molecular weight of 258.32 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentyl-4-phenyl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 110689389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).