About N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide
N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide (PubChem CID 110689603) has the molecular formula C7H5N3O2S
and a molecular weight of 195.20 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 110689603 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cocn1 |
| InChI | InChI=1S/C7H5N3O2S/c11-6(5-3-12-4-9-5)10-7-8-1-2-13-7/h1-4H,(H,8,10,11) |
| InChIKey | HBJHKSYUHSERPI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide (CID 110689603) is N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide is O=C(Nc1nccs1)c1cocn1.
What is the InChIKey of N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
The InChIKey is HBJHKSYUHSERPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2S/c11-6(5-3-12-4-9-5)10-7-8-1-2-13-7/h1-4H,(H,8,10,11).
What are the key properties of N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide has a molecular weight of 195.20 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 110689603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).