C13H18BF4N3O3S — CID 11068998
2-[[(E)-6-hydroxyhex-2-enyl]-methylsulfonylamino]benzenediazonium tetrafluoroborate (PubChem CID 11068998) has the molecular formula C13H18BF4N3O3S and a molecular weight of 383.18 g/mol. Its IUPAC name is 2-[[(E)-6-hydroxyhex-2-enyl]-methylsulfonylamino]benzenediazonium tetrafluoroborate.
| Compound Name | 2-[[(E)-6-hydroxyhex-2-enyl]-methylsulfonylamino]benzenediazonium tetrafluoroborate |
|---|---|
| PubChem CID | 11068998 |
| Molecular Formula | C13H18BF4N3O3S |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[[(E)-6-hydroxyhex-2-enyl]-methylsulfonylamino]benzenediazonium tetrafluoroborate |
| SMILES | CS(=O)(=O)N(C/C=C/CCCO)c1ccccc1[N+]#N.F[B-](F)(F)F |
| InChI | InChI=1S/C13H18N3O3S.BF4/c1-20(18,19)16(10-6-2-3-7-11-17)13-9-5-4-8-12(13)15-14;2-1(3,4)5/h2,4-6,8-9,17H,3,7,10-11H2,1H3;/q+1;-1/b6-2+; |
| InChIKey | XTUUDYICOIUCBV-LKZNWTOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|