C23H34N2O3 — CID 11069110
3,3-dimethyl-1-[(2S)-2-(6-pyridin-3-ylhexanoyl)piperidin-1-yl]pentane-1,2-dione (PubChem CID 11069110) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S)-2-(6-pyridin-3-ylhexanoyl)piperidin-1-yl]pentane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[(2S)-2-(6-pyridin-3-ylhexanoyl)piperidin-1-yl]pentane-1,2-dione |
|---|---|
| PubChem CID | 11069110 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 3,3-dimethyl-1-[(2S)-2-(6-pyridin-3-ylhexanoyl)piperidin-1-yl]pentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)CCCCCc1cccnc1 |
| InChI | InChI=1S/C23H34N2O3/c1-4-23(2,3)21(27)22(28)25-16-9-8-13-19(25)20(26)14-7-5-6-11-18-12-10-15-24-17-18/h10,12,15,17,19H,4-9,11,13-14,16H2,1-3H3/t19-/m0/s1 |
| InChIKey | QJOAYOHFDVJNOX-IBGZPJMESA-N |
| XLogP | 4.14 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|