C19H12Cl2N2O3 — CID 11069119
4-amino-7,9-bis(4-chlorophenyl)-2,8-dioxa-3-azaspiro[4.5]deca-3,6,9-trien-1-one (PubChem CID 11069119) has the molecular formula C19H12Cl2N2O3 and a molecular weight of 387.22 g/mol. Its IUPAC name is 4-amino-7,9-bis(4-chlorophenyl)-2,8-dioxa-3-azaspiro[4.5]deca-3,6,9-trien-1-one.
| Compound Name | 4-amino-7,9-bis(4-chlorophenyl)-2,8-dioxa-3-azaspiro[4.5]deca-3,6,9-trien-1-one |
|---|---|
| PubChem CID | 11069119 |
| Molecular Formula | C19H12Cl2N2O3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 4-amino-7,9-bis(4-chlorophenyl)-2,8-dioxa-3-azaspiro[4.5]deca-3,6,9-trien-1-one |
| SMILES | NC1=NOC(=O)C12C=C(c1ccc(Cl)cc1)OC(c1ccc(Cl)cc1)=C2 |
| InChI | InChI=1S/C19H12Cl2N2O3/c20-13-5-1-11(2-6-13)15-9-19(17(22)23-26-18(19)24)10-16(25-15)12-3-7-14(21)8-4-12/h1-10H,(H2,22,23) |
| InChIKey | UGEQKKQKHKMBKI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|