C26H28N4 — CID 11069321
(3R)-1-cyclohexyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 11069321) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol. Its IUPAC name is (3R)-1-cyclohexyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (3R)-1-cyclohexyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11069321 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (3R)-1-cyclohexyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | c1ccc(-c2cnc([C@H]3Cc4c([nH]c5ccccc45)C(C4CCCCC4)N3)[nH]2)cc1 |
| InChI | InChI=1S/C26H28N4/c1-3-9-17(10-4-1)23-16-27-26(30-23)22-15-20-19-13-7-8-14-21(19)28-25(20)24(29-22)18-11-5-2-6-12-18/h1,3-4,7-10,13-14,16,18,22,24,28-29H,2,5-6,11-12,15H2,(H,27,30)/t22-,24?/m1/s1 |
| InChIKey | CMKNFFUUKQPJOF-LETIRJCYSA-N |
| XLogP | 6.07 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|