C13H23IN2O2S — CID 11069350
[amino-[[(1S,2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohexyl]methylsulfanyl]methylidene]azanium iodide (PubChem CID 11069350) has the molecular formula C13H23IN2O2S and a molecular weight of 398.31 g/mol. Its IUPAC name is [amino-[[(1S,2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohexyl]methylsulfanyl]methylidene]azanium iodide.
| Compound Name | [amino-[[(1S,2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohexyl]methylsulfanyl]methylidene]azanium iodide |
|---|---|
| PubChem CID | 11069350 |
| Molecular Formula | C13H23IN2O2S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [amino-[[(1S,2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclohexyl]methylsulfanyl]methylidene]azanium iodide |
| SMILES | CCOC(=O)/C=C/[C@H]1CCCC[C@@H]1CSC(N)=[NH2+].[I-] |
| InChI | InChI=1S/C13H22N2O2S.HI/c1-2-17-12(16)8-7-10-5-3-4-6-11(10)9-18-13(14)15;/h7-8,10-11H,2-6,9H2,1H3,(H3,14,15);1H/b8-7+;/t10-,11-;/m1./s1 |
| InChIKey | BRXOYXARICSKKP-BGPDUXSWSA-N |
| XLogP | -2.28 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|