C10H14N2O2 — CID 110693621
(3-methylpiperidin-1-yl)-(1,2-oxazol-5-yl)methanone (PubChem CID 110693621) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (3-methylpiperidin-1-yl)-(1,2-oxazol-5-yl)methanone.
| Compound Name | (3-methylpiperidin-1-yl)-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 110693621 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (3-methylpiperidin-1-yl)-(1,2-oxazol-5-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2ccno2)C1 |
| InChI | InChI=1S/C10H14N2O2/c1-8-3-2-6-12(7-8)10(13)9-4-5-11-14-9/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | ZXAAIUCAUJVRMK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |