C12H12N2O2 — CID 110693633
N-(2-ethylphenyl)-1,2-oxazole-5-carboxamide (PubChem CID 110693633) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is N-(2-ethylphenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-ethylphenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110693633 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-(2-ethylphenyl)-1,2-oxazole-5-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1ccno1 |
| InChI | InChI=1S/C12H12N2O2/c1-2-9-5-3-4-6-10(9)14-12(15)11-7-8-13-16-11/h3-8H,2H2,1H3,(H,14,15) |
| InChIKey | ZAQJESXWTVYFQC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |