C12H11FN2O2 — CID 110693729
N-[2-(2-fluorophenyl)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 110693729) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 110693729 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)c1ccon1 |
| InChI | InChI=1S/C12H11FN2O2/c13-10-4-2-1-3-9(10)5-7-14-12(16)11-6-8-17-15-11/h1-4,6,8H,5,7H2,(H,14,16) |
| InChIKey | DZDKRUNVCVAGBP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |