About N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide
N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 110693832) has the molecular formula C8H6N4O2
and a molecular weight of 190.16 g/mol. Its IUPAC name is N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide |
| PubChem CID | 110693832 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ncccn1)c1ccon1 |
| InChI | InChI=1S/C8H6N4O2/c13-7(6-2-5-14-12-6)11-8-9-3-1-4-10-8/h1-5H,(H,9,10,11,13) |
| InChIKey | XVELJAHUBOJIQO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide (CID 110693832) is N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide is O=C(Nc1ncccn1)c1ccon1.
What is the InChIKey of N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide?
The InChIKey is XVELJAHUBOJIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2/c13-7(6-2-5-14-12-6)11-8-9-3-1-4-10-8/h1-5H,(H,9,10,11,13).
What are the key properties of N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide?
N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide has a molecular weight of 190.16 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrimidin-2-yl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 110693832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).