C17H22O11 — CID 11069448
dimethyl (1R,4R,5S,6R,7R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1-(hydroxymethyl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate (PubChem CID 11069448) has the molecular formula C17H22O11 and a molecular weight of 402.35 g/mol. Its IUPAC name is dimethyl (1R,4R,5S,6R,7R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1-(hydroxymethyl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate.
| Compound Name | dimethyl (1R,4R,5S,6R,7R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1-(hydroxymethyl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11069448 |
| Molecular Formula | C17H22O11 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | dimethyl (1R,4R,5S,6R,7R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1-(hydroxymethyl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1CC(=O)[C@@]2(CO)O[C@@H]1[C@H](C(=O)OC)[C@H]2C(=O)OC |
| InChI | InChI=1S/C17H22O11/c1-24-13(20)9(14(21)25-2)7-5-8(19)17(6-18)11(16(23)27-4)10(12(7)28-17)15(22)26-3/h7,9-12,18H,5-6H2,1-4H3/t7-,10-,11+,12+,17-/m1/s1 |
| InChIKey | PEFWATHLPYQRQP-LNKSFRHOSA-N |
| XLogP | -1.75 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|